About N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine
N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine (PubChem CID 146550503) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine.
Molecular Properties
| Compound Name | N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine |
| PubChem CID | 146550503 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine |
| SMILES | CCCC(C)N1CCC=C/C1=N\C |
| InChI | InChI=1S/C11H20N2/c1-4-7-10(2)13-9-6-5-8-11(13)12-3/h5,8,10H,4,6-7,9H2,1-3H3/b12-11+ |
| InChIKey | DKCGHDKAIZDZJN-VAWYXSNFSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine?
The IUPAC name of N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine (CID 146550503) is N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine.
What is the SMILES notation for N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine?
The canonical SMILES for N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine is CCCC(C)N1CCC=C/C1=N\C.
What is the InChIKey of N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine?
The InChIKey is DKCGHDKAIZDZJN-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-7-10(2)13-9-6-5-8-11(13)12-3/h5,8,10H,4,6-7,9H2,1-3H3/b12-11+.
What are the key properties of N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine?
N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine has a molecular weight of 180.30 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-pentan-2-yl-2,3-dihydropyridin-6-imine is sourced from PubChem (CID 146550503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).