About (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine
(2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine (PubChem CID 146550792) has the molecular formula C8H16FN3
and a molecular weight of 173.23 g/mol. Its IUPAC name is (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine |
| PubChem CID | 146550792 |
| Molecular Formula | C8H16FN3 |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine |
| SMILES | CC(=C/CN)/C(F)=C\CN(C)N |
| InChI | InChI=1S/C8H16FN3/c1-7(3-5-10)8(9)4-6-12(2)11/h3-4H,5-6,10-11H2,1-2H3/b7-3-,8-4+ |
| InChIKey | LSKUVRHZPJIGEG-KYPMKJFLSA-N |
| XLogP | 0.55 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine?
The IUPAC name of (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine (CID 146550792) is (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine.
What is the SMILES notation for (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine?
The canonical SMILES for (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine is CC(=C/CN)/C(F)=C\CN(C)N.
What is the InChIKey of (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine?
The InChIKey is LSKUVRHZPJIGEG-KYPMKJFLSA-N. The full InChI is InChI=1S/C8H16FN3/c1-7(3-5-10)8(9)4-6-12(2)11/h3-4H,5-6,10-11H2,1-2H3/b7-3-,8-4+.
What are the key properties of (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine?
(2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine has a molecular weight of 173.23 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-6-[amino(methyl)amino]-4-fluoro-3-methylhexa-2,4-dien-1-amine is sourced from PubChem (CID 146550792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).