About 6-methyl-4a,8a-dihydrophthalazine
6-methyl-4a,8a-dihydrophthalazine (PubChem CID 146550838) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 6-methyl-4a,8a-dihydrophthalazine.
Molecular Properties
| Compound Name | 6-methyl-4a,8a-dihydrophthalazine |
| PubChem CID | 146550838 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 6-methyl-4a,8a-dihydrophthalazine |
| SMILES | CC1=CC2C=NN=CC2C=C1 |
| InChI | InChI=1S/C9H10N2/c1-7-2-3-8-5-10-11-6-9(8)4-7/h2-6,8-9H,1H3 |
| InChIKey | LJFKZALVRPUXSJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-4a,8a-dihydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4a,8a-dihydrophthalazine?
The IUPAC name of 6-methyl-4a,8a-dihydrophthalazine (CID 146550838) is 6-methyl-4a,8a-dihydrophthalazine.
What is the SMILES notation for 6-methyl-4a,8a-dihydrophthalazine?
The canonical SMILES for 6-methyl-4a,8a-dihydrophthalazine is CC1=CC2C=NN=CC2C=C1.
What is the InChIKey of 6-methyl-4a,8a-dihydrophthalazine?
The InChIKey is LJFKZALVRPUXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-2-3-8-5-10-11-6-9(8)4-7/h2-6,8-9H,1H3.
What are the key properties of 6-methyl-4a,8a-dihydrophthalazine?
6-methyl-4a,8a-dihydrophthalazine has a molecular weight of 146.19 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4a,8a-dihydrophthalazine is sourced from PubChem (CID 146550838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).