About spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine
spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine (PubChem CID 146551012) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine.
Molecular Properties
| Compound Name | spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine |
| PubChem CID | 146551012 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine |
| SMILES | Nc1cccc2c1OCC21CC1 |
| InChI | InChI=1S/C10H11NO/c11-8-3-1-2-7-9(8)12-6-10(7)4-5-10/h1-3H,4-6,11H2 |
| InChIKey | IECRIBWYCDRALH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine?
The IUPAC name of spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine (CID 146551012) is spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine.
What is the SMILES notation for spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine?
The canonical SMILES for spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine is Nc1cccc2c1OCC21CC1.
What is the InChIKey of spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine?
The InChIKey is IECRIBWYCDRALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c11-8-3-1-2-7-9(8)12-6-10(7)4-5-10/h1-3H,4-6,11H2.
What are the key properties of spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine?
spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine has a molecular weight of 161.20 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2H-1-benzofuran-3,1'-cyclopropane]-7-amine is sourced from PubChem (CID 146551012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).