C12H19NO — CID 146551243
(4E,6Z)-5-(methylamino)-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-1-ol (PubChem CID 146551243) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (4E,6Z)-5-(methylamino)-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-1-ol.
| Compound Name | (4E,6Z)-5-(methylamino)-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 146551243 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (4E,6Z)-5-(methylamino)-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-1-ol |
| SMILES | C/C=C\C(CC=CO)=C(/C=C\C)NC |
| InChI | InChI=1S/C12H19NO/c1-4-7-11(9-6-10-14)12(13-3)8-5-2/h4-8,10,13-14H,9H2,1-3H3/b7-4-,8-5-,10-6?,12-11- |
| InChIKey | CWKGFHGJDWYZIR-GDLWYMCDSA-N |
| XLogP | 3.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|