About (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile
(2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile (PubChem CID 146551316) has the molecular formula C7H8FN
and a molecular weight of 125.15 g/mol. Its IUPAC name is (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile |
| PubChem CID | 146551316 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile |
| SMILES | C/C=C\C=C(\C#N)CF |
| InChI | InChI=1S/C7H8FN/c1-2-3-4-7(5-8)6-9/h2-4H,5H2,1H3/b3-2-,7-4+ |
| InChIKey | XIXDVPOBHHAEHF-UDJLOATDSA-N |
| XLogP | 1.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile?
The IUPAC name of (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile (CID 146551316) is (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile.
What is the SMILES notation for (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile?
The canonical SMILES for (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile is C/C=C\C=C(\C#N)CF.
What is the InChIKey of (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile?
The InChIKey is XIXDVPOBHHAEHF-UDJLOATDSA-N. The full InChI is InChI=1S/C7H8FN/c1-2-3-4-7(5-8)6-9/h2-4H,5H2,1H3/b3-2-,7-4+.
What are the key properties of (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile?
(2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile has a molecular weight of 125.15 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-(fluoromethyl)hexa-2,4-dienenitrile is sourced from PubChem (CID 146551316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).