About N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine
N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine (PubChem CID 146551795) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine |
| PubChem CID | 146551795 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine |
| SMILES | CCCC1=CC=C(CCC(C)CC)NC1NC |
| InChI | InChI=1S/C15H28N2/c1-5-7-13-9-11-14(17-15(13)16-4)10-8-12(3)6-2/h9,11-12,15-17H,5-8,10H2,1-4H3 |
| InChIKey | VQSGHJIDPOHFOZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine?
The IUPAC name of N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine (CID 146551795) is N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine.
What is the SMILES notation for N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine?
The canonical SMILES for N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine is CCCC1=CC=C(CCC(C)CC)NC1NC.
What is the InChIKey of N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine?
The InChIKey is VQSGHJIDPOHFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2/c1-5-7-13-9-11-14(17-15(13)16-4)10-8-12(3)6-2/h9,11-12,15-17H,5-8,10H2,1-4H3.
What are the key properties of N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine?
N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine has a molecular weight of 236.40 g/mol, XLogP of 3.57, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(3-methylpentyl)-3-propyl-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 146551795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).