C31H42O8 — CID 146551833
dimethyl (4R,7E,9E,11E,13E)-4-acetyloxy-13-(acetyloxymethyl)-3,5,14-triethyltricyclo[8.4.2.02,7]hexadeca-7,9,11,13-tetraene-6,11-dicarboxylate (PubChem CID 146551833) has the molecular formula C31H42O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is dimethyl (4R,7E,9E,11E,13E)-4-acetyloxy-13-(acetyloxymethyl)-3,5,14-triethyltricyclo[8.4.2.02,7]hexadeca-7,9,11,13-tetraene-6,11-dicarboxylate.
| Compound Name | dimethyl (4R,7E,9E,11E,13E)-4-acetyloxy-13-(acetyloxymethyl)-3,5,14-triethyltricyclo[8.4.2.02,7]hexadeca-7,9,11,13-tetraene-6,11-dicarboxylate |
|---|---|
| PubChem CID | 146551833 |
| Molecular Formula | C31H42O8 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | dimethyl (4R,7E,9E,11E,13E)-4-acetyloxy-13-(acetyloxymethyl)-3,5,14-triethyltricyclo[8.4.2.02,7]hexadeca-7,9,11,13-tetraene-6,11-dicarboxylate |
| SMILES | CC/C1=C(COC(C)=O)/C=C(C(=O)OC)\C2=C/C=C3/C(C(=O)OC)C(CC)[C@H](OC(C)=O)C(CC)C3C1CC2 |
| InChI | InChI=1S/C31H42O8/c1-8-21-20(16-38-17(4)32)15-26(30(34)36-6)19-11-13-24(21)27-22(9-2)29(39-18(5)33)23(10-3)28(31(35)37-7)25(27)14-12-19/h12,14-15,22-24,27-29H,8-11,13,16H2,1-7H3/b19-12-,21-20+,25-14+,26-15+/t22?,23?,24?,27?,28?,29-/m1/s1 |
| InChIKey | DBVVYUMGDLBFRJ-IGTGAECHSA-N |
| XLogP | 5.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|