About 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine
6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine (PubChem CID 146552784) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine |
| PubChem CID | 146552784 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine |
| SMILES | CC(C)c1nnc(-c2ccc(N)cn2)o1 |
| InChI | InChI=1S/C10H12N4O/c1-6(2)9-13-14-10(15-9)8-4-3-7(11)5-12-8/h3-6H,11H2,1-2H3 |
| InChIKey | IZUYYHUINRBNKN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine?
The IUPAC name of 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine (CID 146552784) is 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine.
What is the SMILES notation for 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine?
The canonical SMILES for 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine is CC(C)c1nnc(-c2ccc(N)cn2)o1.
What is the InChIKey of 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine?
The InChIKey is IZUYYHUINRBNKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-6(2)9-13-14-10(15-9)8-4-3-7(11)5-12-8/h3-6H,11H2,1-2H3.
What are the key properties of 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine?
6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine has a molecular weight of 204.23 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)pyridin-3-amine is sourced from PubChem (CID 146552784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).