About methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate
methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate (PubChem CID 146553274) has the molecular formula C24H23NO5
and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate.
Molecular Properties
| Compound Name | methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate |
| PubChem CID | 146553274 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](NC(=O)CCCC1=C(C)C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO5/c1-15-17(23(28)19-12-7-6-11-18(19)22(15)27)13-8-14-20(26)25-21(24(29)30-2)16-9-4-3-5-10-16/h3-7,9-12,21H,8,13-14H2,1-2H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | YFIAIUKVFYZIJO-NRFANRHFSA-N |
| XLogP | 3.58 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate?
The IUPAC name of methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate (CID 146553274) is methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate.
What is the SMILES notation for methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate?
The canonical SMILES for methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate is COC(=O)[C@@H](NC(=O)CCCC1=C(C)C(=O)c2ccccc2C1=O)c1ccccc1.
What is the InChIKey of methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate?
The InChIKey is YFIAIUKVFYZIJO-NRFANRHFSA-N. The full InChI is InChI=1S/C24H23NO5/c1-15-17(23(28)19-12-7-6-11-18(19)22(15)27)13-8-14-20(26)25-21(24(29)30-2)16-9-4-3-5-10-16/h3-7,9-12,21H,8,13-14H2,1-2H3,(H,25,26)/t21-/m0/s1.
What are the key properties of methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate?
methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate has a molecular weight of 405.45 g/mol, XLogP of 3.58, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-2-phenylacetate is sourced from PubChem (CID 146553274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).