About 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine
4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine (PubChem CID 146553418) has the molecular formula C13H14ClN
and a molecular weight of 219.71 g/mol. Its IUPAC name is 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine.
Molecular Properties
| Compound Name | 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine |
| PubChem CID | 146553418 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1ccc(CCl)c2ccccc12 |
| InChI | InChI=1S/C13H14ClN/c1-15(2)13-8-7-10(9-14)11-5-3-4-6-12(11)13/h3-8H,9H2,1-2H3 |
| InChIKey | IZAWXAUFKOMLCP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine?
The IUPAC name of 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine (CID 146553418) is 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine.
What is the SMILES notation for 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine?
The canonical SMILES for 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine is CN(C)c1ccc(CCl)c2ccccc12.
What is the InChIKey of 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine?
The InChIKey is IZAWXAUFKOMLCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN/c1-15(2)13-8-7-10(9-14)11-5-3-4-6-12(11)13/h3-8H,9H2,1-2H3.
What are the key properties of 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine?
4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine has a molecular weight of 219.71 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-N,N-dimethylnaphthalen-1-amine is sourced from PubChem (CID 146553418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).