C20H40N2 — CID 146553524
N'-(7,8-dimethylnona-1,8-dien-2-yl)-N-propan-2-ylhexane-1,6-diamine (PubChem CID 146553524) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is N'-(7,8-dimethylnona-1,8-dien-2-yl)-N-propan-2-ylhexane-1,6-diamine.
| Compound Name | N'-(7,8-dimethylnona-1,8-dien-2-yl)-N-propan-2-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 146553524 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | N'-(7,8-dimethylnona-1,8-dien-2-yl)-N-propan-2-ylhexane-1,6-diamine |
| SMILES | C=C(CCCCC(C)C(=C)C)NCCCCCCNC(C)C |
| InChI | InChI=1S/C20H40N2/c1-17(2)19(5)13-9-10-14-20(6)22-16-12-8-7-11-15-21-18(3)4/h18-19,21-22H,1,6-16H2,2-5H3 |
| InChIKey | OLXLURAFBFZLHQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|