C18H21FN6O2 — CID 146554650
6-fluoro-3-propan-2-yl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1,4(9),5,7,15(22),19-hexaen-14-one (PubChem CID 146554650) has the molecular formula C18H21FN6O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 6-fluoro-3-propan-2-yl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1,4(9),5,7,15(22),19-hexaen-14-one.
| Compound Name | 6-fluoro-3-propan-2-yl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1,4(9),5,7,15(22),19-hexaen-14-one |
|---|---|
| PubChem CID | 146554650 |
| Molecular Formula | C18H21FN6O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 6-fluoro-3-propan-2-yl-10-oxa-2,8,13,17,18,21-hexazatetracyclo[13.5.2.04,9.018,22]docosa-1,4(9),5,7,15(22),19-hexaen-14-one |
| SMILES | CC(C)C1/N=C2/C=CN3NCC(=C3N2)C(=O)NCCOc2ncc(F)cc21 |
| InChI | InChI=1S/C18H21FN6O2/c1-10(2)15-12-7-11(19)8-21-18(12)27-6-4-20-17(26)13-9-22-25-5-3-14(23-15)24-16(13)25/h3,5,7-8,10,15,22H,4,6,9H2,1-2H3,(H,20,26)(H,23,24) |
| InChIKey | JPDUNVVWJCBKBB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |