C22H15NO3 — CID 146554692
2-[(2,4-dimethylfuro[3,2-b]pyrrol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 146554692) has the molecular formula C22H15NO3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[(2,4-dimethylfuro[3,2-b]pyrrol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2,4-dimethylfuro[3,2-b]pyrrol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 146554692 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[(2,4-dimethylfuro[3,2-b]pyrrol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cc1cc2c(cc(C=C3C(=O)c4cc5ccccc5cc4C3=O)n2C)o1 |
| InChI | InChI=1S/C22H15NO3/c1-12-7-19-20(26-12)11-15(23(19)2)10-18-21(24)16-8-13-5-3-4-6-14(13)9-17(16)22(18)25/h3-11H,1-2H3 |
| InChIKey | CRBCCSQRVRGKST-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|