C38H22F9NO2S — CID 146554771
2-[[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(4-phenylphenyl)thieno[3,2-b]pyrrol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 146554771) has the molecular formula C38H22F9NO2S and a molecular weight of 727.65 g/mol. Its IUPAC name is 2-[[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(4-phenylphenyl)thieno[3,2-b]pyrrol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(4-phenylphenyl)thieno[3,2-b]pyrrol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 146554771 |
| Molecular Formula | C38H22F9NO2S |
| Molecular Weight | 727.65 g/mol |
| Exact Mass | 727.12 |
| IUPAC Name | 2-[[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2-(4-phenylphenyl)thieno[3,2-b]pyrrol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3sc(-c4ccc(-c5ccccc5)cc4)cc3n2CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C38H22F9NO2S/c39-35(40,36(41,42)37(43,44)38(45,46)47)14-15-48-26(18-29-33(49)27-16-24-8-4-5-9-25(24)17-28(27)34(29)50)19-32-30(48)20-31(51-32)23-12-10-22(11-13-23)21-6-2-1-3-7-21/h1-13,16-20H,14-15H2 |
| InChIKey | SBORXFUEOILSGB-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.65 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|