C13H20N2 — CID 146555145
N,N,2,3-tetramethyl-4,4a,5,6-tetrahydroquinolin-7-amine (PubChem CID 146555145) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N,N,2,3-tetramethyl-4,4a,5,6-tetrahydroquinolin-7-amine.
| Compound Name | N,N,2,3-tetramethyl-4,4a,5,6-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 146555145 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N,N,2,3-tetramethyl-4,4a,5,6-tetrahydroquinolin-7-amine |
| SMILES | CC1=C(C)N=C2C=C(N(C)C)CCC2C1 |
| InChI | InChI=1S/C13H20N2/c1-9-7-11-5-6-12(15(3)4)8-13(11)14-10(9)2/h8,11H,5-7H2,1-4H3 |
| InChIKey | FVDCIQUDCWGECW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |