C15H24N4OS — CID 146555271
N-(2-aminoethyl)-1-[5-(1-sulfanylethyl)-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 146555271) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[5-(1-sulfanylethyl)-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[5-(1-sulfanylethyl)-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 146555271 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-(2-aminoethyl)-1-[5-(1-sulfanylethyl)-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | CC(S)c1ccc(N2CCC(C(=O)NCCN)CC2)nc1 |
| InChI | InChI=1S/C15H24N4OS/c1-11(21)13-2-3-14(18-10-13)19-8-4-12(5-9-19)15(20)17-7-6-16/h2-3,10-12,21H,4-9,16H2,1H3,(H,17,20) |
| InChIKey | VWJHVIJJIFTOCN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|