About [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate
[2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 146555603) has the molecular formula C10H10F2O6
and a molecular weight of 264.18 g/mol. Its IUPAC name is [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate |
| PubChem CID | 146555603 |
| Molecular Formula | C10H10F2O6 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1CC(F)(F)OC1=O |
| InChI | InChI=1S/C10H10F2O6/c1-5(2)8(14)16-4-7(13)17-6-3-10(11,12)18-9(6)15/h6H,1,3-4H2,2H3 |
| InChIKey | MPDONRIHZBIGPP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate?
The IUPAC name of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate (CID 146555603) is [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate.
What is the SMILES notation for [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate?
The canonical SMILES for [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCC(=O)OC1CC(F)(F)OC1=O.
What is the InChIKey of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate?
The InChIKey is MPDONRIHZBIGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O6/c1-5(2)8(14)16-4-7(13)17-6-3-10(11,12)18-9(6)15/h6H,1,3-4H2,2H3.
What are the key properties of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate?
[2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate has a molecular weight of 264.18 g/mol, XLogP of 0.56, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate is sourced from PubChem (CID 146555603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).