C26H19F3N6O2 — CID 146555949
4-methyl-3-(9-methyl-2-pyridin-3-ylpurin-6-yl)oxy-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 146555949) has the molecular formula C26H19F3N6O2 and a molecular weight of 504.47 g/mol. Its IUPAC name is 4-methyl-3-(9-methyl-2-pyridin-3-ylpurin-6-yl)oxy-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-methyl-3-(9-methyl-2-pyridin-3-ylpurin-6-yl)oxy-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 146555949 |
| Molecular Formula | C26H19F3N6O2 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 4-methyl-3-(9-methyl-2-pyridin-3-ylpurin-6-yl)oxy-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1Oc1nc(-c2cccnc2)nc2c1ncn2C |
| InChI | InChI=1S/C26H19F3N6O2/c1-15-8-9-16(24(36)32-19-7-3-6-18(12-19)26(27,28)29)11-20(15)37-25-21-23(35(2)14-31-21)33-22(34-25)17-5-4-10-30-13-17/h3-14H,1-2H3,(H,32,36) |
| InChIKey | YXRBLFSLVHZDAG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |