About (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide
(3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide (PubChem CID 146556388) has the molecular formula C11H19NO2S
and a molecular weight of 229.34 g/mol. Its IUPAC name is (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide.
Molecular Properties
| Compound Name | (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide |
| PubChem CID | 146556388 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide |
| SMILES | C=C(/C(=C\C)C1CCCCC1)S(N)(=O)=O |
| InChI | InChI=1S/C11H19NO2S/c1-3-11(9(2)15(12,13)14)10-7-5-4-6-8-10/h3,10H,2,4-8H2,1H3,(H2,12,13,14)/b11-3+ |
| InChIKey | IQDFPSJRBXDBQY-QDEBKDIKSA-N |
| XLogP | 2.32 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide?
The IUPAC name of (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide (CID 146556388) is (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide.
What is the SMILES notation for (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide?
The canonical SMILES for (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide is C=C(/C(=C\C)C1CCCCC1)S(N)(=O)=O.
What is the InChIKey of (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide?
The InChIKey is IQDFPSJRBXDBQY-QDEBKDIKSA-N. The full InChI is InChI=1S/C11H19NO2S/c1-3-11(9(2)15(12,13)14)10-7-5-4-6-8-10/h3,10H,2,4-8H2,1H3,(H2,12,13,14)/b11-3+.
What are the key properties of (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide?
(3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide has a molecular weight of 229.34 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-cyclohexylpenta-1,3-diene-2-sulfonamide is sourced from PubChem (CID 146556388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).