C21H32N2O3S — CID 146556707
(2R,3R)-3-amino-2-hydroxy-4-propan-2-ylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanal (PubChem CID 146556707) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is (2R,3R)-3-amino-2-hydroxy-4-propan-2-ylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanal.
| Compound Name | (2R,3R)-3-amino-2-hydroxy-4-propan-2-ylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanal |
|---|---|
| PubChem CID | 146556707 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2R,3R)-3-amino-2-hydroxy-4-propan-2-ylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanal |
| SMILES | CC(C)SC[C@H](N)[C@@](O)(C=O)Cc1cc(OC2CCC3(CC2)CC3)ccn1 |
| InChI | InChI=1S/C21H32N2O3S/c1-15(2)27-13-19(22)21(25,14-24)12-16-11-18(5-10-23-16)26-17-3-6-20(7-4-17)8-9-20/h5,10-11,14-15,17,19,25H,3-4,6-9,12-13,22H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | RQDQMRKBYIRRGH-FPOVZHCZSA-N |
| XLogP | 3.12 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|