About 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide
2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide (PubChem CID 14655679) has the molecular formula C11H18N2OS3
and a molecular weight of 290.48 g/mol. Its IUPAC name is 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide |
| PubChem CID | 14655679 |
| Molecular Formula | C11H18N2OS3 |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide |
| SMILES | CC(C)SC1CSC(C#N)(C(=O)N(C)C)SC1 |
| InChI | InChI=1S/C11H18N2OS3/c1-8(2)17-9-5-15-11(7-12,16-6-9)10(14)13(3)4/h8-9H,5-6H2,1-4H3 |
| InChIKey | AEKKKFPZEDQFBF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide?
The IUPAC name of 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide (CID 14655679) is 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide.
What is the SMILES notation for 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide?
The canonical SMILES for 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide is CC(C)SC1CSC(C#N)(C(=O)N(C)C)SC1.
What is the InChIKey of 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide?
The InChIKey is AEKKKFPZEDQFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS3/c1-8(2)17-9-5-15-11(7-12,16-6-9)10(14)13(3)4/h8-9H,5-6H2,1-4H3.
What are the key properties of 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide?
2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide has a molecular weight of 290.48 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N,N-dimethyl-5-propan-2-ylsulfanyl-1,3-dithiane-2-carboxamide is sourced from PubChem (CID 14655679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).