C15H22F3N5O3 — CID 146556939
N-[2-[2-[[(E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enyl]amino]ethyl-ethylamino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 146556939) has the molecular formula C15H22F3N5O3 and a molecular weight of 377.37 g/mol. Its IUPAC name is N-[2-[2-[[(E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enyl]amino]ethyl-ethylamino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-[[(E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enyl]amino]ethyl-ethylamino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 146556939 |
| Molecular Formula | C15H22F3N5O3 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[2-[2-[[(E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enyl]amino]ethyl-ethylamino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN(CCNC/C=C/c1c[nH]c(=O)[nH]c1=O)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H22F3N5O3/c1-2-23(9-7-20-13(25)15(16,17)18)8-6-19-5-3-4-11-10-21-14(26)22-12(11)24/h3-4,10,19H,2,5-9H2,1H3,(H,20,25)(H2,21,22,24,26)/b4-3+ |
| InChIKey | FUPMVNDDOYGKNL-ONEGZZNKSA-N |
| XLogP | -0.33 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|