C22H30O3Si — CID 14655750
11-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,3b,9b,10-hexahydro-1H-indeno[4,5-c]chromen-4-one (PubChem CID 14655750) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is 11-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,3b,9b,10-hexahydro-1H-indeno[4,5-c]chromen-4-one.
| Compound Name | 11-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,3b,9b,10-hexahydro-1H-indeno[4,5-c]chromen-4-one |
|---|---|
| PubChem CID | 14655750 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 11-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,3b,9b,10-hexahydro-1H-indeno[4,5-c]chromen-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCC2C2C(=O)Oc3ccccc3C2C1 |
| InChI | InChI=1S/C22H30O3Si/c1-22(2,3)26(4,5)25-19-13-17-15-9-6-7-12-18(15)24-21(23)20(17)16-11-8-10-14(16)19/h6-7,9,12,16-17,20H,8,10-11,13H2,1-5H3 |
| InChIKey | ZUGIVQDTQXIERC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|