C16H19N — CID 146557645
6-methylidene-N-[(2Z,4E,6Z)-5-methylocta-2,4,6-trien-4-yl]cyclohexa-2,4-dien-1-imine (PubChem CID 146557645) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 6-methylidene-N-[(2Z,4E,6Z)-5-methylocta-2,4,6-trien-4-yl]cyclohexa-2,4-dien-1-imine.
| Compound Name | 6-methylidene-N-[(2Z,4E,6Z)-5-methylocta-2,4,6-trien-4-yl]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 146557645 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 6-methylidene-N-[(2Z,4E,6Z)-5-methylocta-2,4,6-trien-4-yl]cyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC=C/C1=N/C(/C=C\C)=C(C)/C=C\C |
| InChI | InChI=1S/C16H19N/c1-5-9-13(3)15(10-6-2)17-16-12-8-7-11-14(16)4/h5-12H,4H2,1-3H3/b9-5-,10-6-,15-13+,17-16+ |
| InChIKey | DTKPEOACMVLFEZ-LPTRHGAZSA-N |
| XLogP | 4.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|