C15H19N5O — CID 146558614
N-[(1R,3R)-3-[(5-cyclopropylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]formamide (PubChem CID 146558614) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[(1R,3R)-3-[(5-cyclopropylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]formamide.
| Compound Name | N-[(1R,3R)-3-[(5-cyclopropylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]formamide |
|---|---|
| PubChem CID | 146558614 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[(1R,3R)-3-[(5-cyclopropylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]formamide |
| SMILES | O=CN[C@@H]1CC[C@@H](Nc2cc(C3CC3)nc3ccnn23)C1 |
| InChI | InChI=1S/C15H19N5O/c21-9-16-11-3-4-12(7-11)18-15-8-13(10-1-2-10)19-14-5-6-17-20(14)15/h5-6,8-12,18H,1-4,7H2,(H,16,21)/t11-,12-/m1/s1 |
| InChIKey | RMTCCDRXQOEOMZ-VXGBXAGGSA-N |
| XLogP | 1.69 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|