C23H24FN7O3 — CID 146559227
5-[1-[(3R,4R)-4-fluorooxolan-3-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1S,2R)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146559227) has the molecular formula C23H24FN7O3 and a molecular weight of 465.49 g/mol. Its IUPAC name is 5-[1-[(3R,4R)-4-fluorooxolan-3-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1S,2R)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[1-[(3R,4R)-4-fluorooxolan-3-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1S,2R)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146559227 |
| Molecular Formula | C23H24FN7O3 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 5-[1-[(3R,4R)-4-fluorooxolan-3-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1S,2R)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CNc1cc(-c2cn([C@@H]3COC[C@@H]3F)c3ncccc23)nc2c(C(=O)N[C@H]3CC[C@H]3O)cnn12 |
| InChI | InChI=1S/C23H24FN7O3/c1-25-20-7-17(28-22-13(8-27-31(20)22)23(33)29-16-4-5-19(16)32)14-9-30(18-11-34-10-15(18)24)21-12(14)3-2-6-26-21/h2-3,6-9,15-16,18-19,25,32H,4-5,10-11H2,1H3,(H,29,33)/t15-,16-,18+,19+/m0/s1 |
| InChIKey | ZCONRYMDXTVKRQ-RNIPGJKVSA-N |
| XLogP | 1.95 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |