C12H20N8 — CID 146559480
3,6-bis(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazinane (PubChem CID 146559480) has the molecular formula C12H20N8 and a molecular weight of 276.35 g/mol. Its IUPAC name is 3,6-bis(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazinane.
| Compound Name | 3,6-bis(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazinane |
|---|---|
| PubChem CID | 146559480 |
| Molecular Formula | C12H20N8 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3,6-bis(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazinane |
| SMILES | Cc1cc(C)n(C2NNC(n3nc(C)cc3C)NN2)n1 |
| InChI | InChI=1S/C12H20N8/c1-7-5-9(3)19(17-7)11-13-15-12(16-14-11)20-10(4)6-8(2)18-20/h5-6,11-16H,1-4H3 |
| InChIKey | UEIOBHLEXXZHRF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |