C10H18N2O2 — CID 146559535
(2R,4E,6Z)-2-amino-1-methoxy-4-methyl-7-(methylideneamino)hepta-4,6-dien-1-ol (PubChem CID 146559535) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (2R,4E,6Z)-2-amino-1-methoxy-4-methyl-7-(methylideneamino)hepta-4,6-dien-1-ol.
| Compound Name | (2R,4E,6Z)-2-amino-1-methoxy-4-methyl-7-(methylideneamino)hepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 146559535 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (2R,4E,6Z)-2-amino-1-methoxy-4-methyl-7-(methylideneamino)hepta-4,6-dien-1-ol |
| SMILES | C=N/C=C\C=C(/C)C[C@@H](N)C(O)OC |
| InChI | InChI=1S/C10H18N2O2/c1-8(5-4-6-12-2)7-9(11)10(13)14-3/h4-6,9-10,13H,2,7,11H2,1,3H3/b6-4-,8-5+/t9-,10?/m1/s1 |
| InChIKey | XVXPRKKOVMNQCJ-BZXOPVMBSA-N |
| XLogP | 0.83 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|