C13H20 — CID 14656044
(2E,4E,6E,8E)-3,5,7-trimethyldeca-2,4,6,8-tetraene (PubChem CID 14656044) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,5,7-trimethyldeca-2,4,6,8-tetraene.
| Compound Name | (2E,4E,6E,8E)-3,5,7-trimethyldeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 14656044 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (2E,4E,6E,8E)-3,5,7-trimethyldeca-2,4,6,8-tetraene |
| SMILES | C/C=C/C(C)=C/C(C)=C/C(C)=C/C |
| InChI | InChI=1S/C13H20/c1-6-8-12(4)10-13(5)9-11(3)7-2/h6-10H,1-5H3/b8-6+,11-7+,12-10+,13-9+ |
| InChIKey | RRPFGKUHEMWGSW-RYNMLCPOSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|