C14H22 — CID 14656047
(2E,4E,6E,8E)-3,5,7-trimethylundeca-2,4,6,8-tetraene (PubChem CID 14656047) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,5,7-trimethylundeca-2,4,6,8-tetraene.
| Compound Name | (2E,4E,6E,8E)-3,5,7-trimethylundeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 14656047 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (2E,4E,6E,8E)-3,5,7-trimethylundeca-2,4,6,8-tetraene |
| SMILES | C/C=C(C)/C=C(C)/C=C(C)/C=C/CC |
| InChI | InChI=1S/C14H22/c1-6-8-9-13(4)11-14(5)10-12(3)7-2/h7-11H,6H2,1-5H3/b9-8+,12-7+,13-11+,14-10+ |
| InChIKey | PEQDBIZKCMKPKU-VTCWLERASA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|