C27H36N8O — CID 146561491
1-N-[3-(dimethylamino)propyl]-5-methoxy-1-N,2-N-dimethyl-4-N-[6-(1-methylindazol-5-yl)pyrimidin-4-yl]cyclohepta-1,3,6-triene-1,2,4-triamine (PubChem CID 146561491) has the molecular formula C27H36N8O and a molecular weight of 488.64 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-5-methoxy-1-N,2-N-dimethyl-4-N-[6-(1-methylindazol-5-yl)pyrimidin-4-yl]cyclohepta-1,3,6-triene-1,2,4-triamine.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-5-methoxy-1-N,2-N-dimethyl-4-N-[6-(1-methylindazol-5-yl)pyrimidin-4-yl]cyclohepta-1,3,6-triene-1,2,4-triamine |
|---|---|
| PubChem CID | 146561491 |
| Molecular Formula | C27H36N8O |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-5-methoxy-1-N,2-N-dimethyl-4-N-[6-(1-methylindazol-5-yl)pyrimidin-4-yl]cyclohepta-1,3,6-triene-1,2,4-triamine |
| SMILES | CNC1=C(N(C)CCCN(C)C)C=CC(OC)C(Nc2cc(-c3ccc4c(cnn4C)c3)ncn2)=C1 |
| InChI | InChI=1S/C27H36N8O/c1-28-22-15-23(26(36-6)11-10-25(22)34(4)13-7-12-33(2)3)32-27-16-21(29-18-30-27)19-8-9-24-20(14-19)17-31-35(24)5/h8-11,14-18,26,28H,7,12-13H2,1-6H3,(H,29,30,32) |
| InChIKey | PRGXBEHKRFVODV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |