C14H25F2N3O — CID 146561503
(2Z,4Z)-6-(difluoromethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N,3-N-dimethylhepta-2,4,6-triene-2,3-diamine (PubChem CID 146561503) has the molecular formula C14H25F2N3O and a molecular weight of 289.37 g/mol. Its IUPAC name is (2Z,4Z)-6-(difluoromethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N,3-N-dimethylhepta-2,4,6-triene-2,3-diamine.
| Compound Name | (2Z,4Z)-6-(difluoromethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N,3-N-dimethylhepta-2,4,6-triene-2,3-diamine |
|---|---|
| PubChem CID | 146561503 |
| Molecular Formula | C14H25F2N3O |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2Z,4Z)-6-(difluoromethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N,3-N-dimethylhepta-2,4,6-triene-2,3-diamine |
| SMILES | C=C(/C=C\C(NC)=C(/C)N(C)CCN(C)C)OC(F)F |
| InChI | InChI=1S/C14H25F2N3O/c1-11(20-14(15)16)7-8-13(17-3)12(2)19(6)10-9-18(4)5/h7-8,14,17H,1,9-10H2,2-6H3/b8-7-,13-12- |
| InChIKey | NUZLASTZSCYOTO-QOTUMQCOSA-N |
| XLogP | 2.24 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|