C17H32N2O2 — CID 146561839
1-[2-(2-methylprop-2-enoxy)ethyl]-3-[(4-propan-2-ylcyclohexyl)methyl]urea (PubChem CID 146561839) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-[2-(2-methylprop-2-enoxy)ethyl]-3-[(4-propan-2-ylcyclohexyl)methyl]urea.
| Compound Name | 1-[2-(2-methylprop-2-enoxy)ethyl]-3-[(4-propan-2-ylcyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 146561839 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-[2-(2-methylprop-2-enoxy)ethyl]-3-[(4-propan-2-ylcyclohexyl)methyl]urea |
| SMILES | C=C(C)COCCNC(=O)NCC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C17H32N2O2/c1-13(2)12-21-10-9-18-17(20)19-11-15-5-7-16(8-6-15)14(3)4/h14-16H,1,5-12H2,2-4H3,(H2,18,19,20) |
| InChIKey | JBUCTECCJVDPBU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|