About 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione
4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 146562971) has the molecular formula C16H15N3O2S
and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| PubChem CID | 146562971 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(O)c(-c2n[nH]c(=S)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3O2S/c1-21-12-7-8-14(20)13(9-12)15-17-18-16(22)19(15)10-11-5-3-2-4-6-11/h2-9,20H,10H2,1H3,(H,18,22) |
| InChIKey | SRMDEQXOBBCPEG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione?
The IUPAC name of 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione (CID 146562971) is 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione is COc1ccc(O)c(-c2n[nH]c(=S)n2Cc2ccccc2)c1.
What is the InChIKey of 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione?
The InChIKey is SRMDEQXOBBCPEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2S/c1-21-12-7-8-14(20)13(9-12)15-17-18-16(22)19(15)10-11-5-3-2-4-6-11/h2-9,20H,10H2,1H3,(H,18,22).
What are the key properties of 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione?
4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione has a molecular weight of 313.38 g/mol, XLogP of 3.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3-(2-hydroxy-5-methoxyphenyl)-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 146562971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).