About azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid
azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid (PubChem CID 146563006) has the molecular formula C15H19IN4O2
and a molecular weight of 414.25 g/mol. Its IUPAC name is azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid |
| PubChem CID | 146563006 |
| Molecular Formula | C15H19IN4O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid |
| SMILES | CC(c1ccc(I)cc1)n1cncc1C(=O)O.NN1CCC1 |
| InChI | InChI=1S/C12H11IN2O2.C3H8N2/c1-8(9-2-4-10(13)5-3-9)15-7-14-6-11(15)12(16)17;4-5-2-1-3-5/h2-8H,1H3,(H,16,17);1-4H2 |
| InChIKey | SNQXJTCCDWTCJE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid?
The IUPAC name of azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid (CID 146563006) is azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid.
What is the SMILES notation for azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid?
The canonical SMILES for azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid is CC(c1ccc(I)cc1)n1cncc1C(=O)O.NN1CCC1.
What is the InChIKey of azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid?
The InChIKey is SNQXJTCCDWTCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11IN2O2.C3H8N2/c1-8(9-2-4-10(13)5-3-9)15-7-14-6-11(15)12(16)17;4-5-2-1-3-5/h2-8H,1H3,(H,16,17);1-4H2.
What are the key properties of azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid?
azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid has a molecular weight of 414.25 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-amine;3-[1-(4-iodophenyl)ethyl]imidazole-4-carboxylic acid is sourced from PubChem (CID 146563006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).