C17H17ClF3N5O2S — CID 146563046
2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]-3,3,3-trifluoropropanoic acid (PubChem CID 146563046) has the molecular formula C17H17ClF3N5O2S and a molecular weight of 447.87 g/mol. Its IUPAC name is 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 146563046 |
| Molecular Formula | C17H17ClF3N5O2S |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[1-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]-3,3,3-trifluoropropanoic acid |
| SMILES | Nc1cccc(Sc2ncc(N3CCC(C(C(=O)O)C(F)(F)F)C3)nc2N)c1Cl |
| InChI | InChI=1S/C17H17ClF3N5O2S/c18-13-9(22)2-1-3-10(13)29-15-14(23)25-11(6-24-15)26-5-4-8(7-26)12(16(27)28)17(19,20)21/h1-3,6,8,12H,4-5,7,22H2,(H2,23,25)(H,27,28) |
| InChIKey | NLBYQNNQGSXIAD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|