About bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate
bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate (PubChem CID 146563175) has the molecular formula C15H28N2O5
and a molecular weight of 316.40 g/mol. Its IUPAC name is bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate.
Molecular Properties
| Compound Name | bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate |
| PubChem CID | 146563175 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate |
| SMILES | CC(C)COC(=O)C[C@H](NC(=O)[C@@H](C)N)C(=O)OCC(C)C |
| InChI | InChI=1S/C15H28N2O5/c1-9(2)7-21-13(18)6-12(17-14(19)11(5)16)15(20)22-8-10(3)4/h9-12H,6-8,16H2,1-5H3,(H,17,19)/t11-,12+/m1/s1 |
| InChIKey | NIHBYSOHEUHRKY-NEPJUHHUSA-N |
| XLogP | 0.61 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate?
The IUPAC name of bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate (CID 146563175) is bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate.
What is the SMILES notation for bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate?
The canonical SMILES for bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate is CC(C)COC(=O)C[C@H](NC(=O)[C@@H](C)N)C(=O)OCC(C)C.
What is the InChIKey of bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate?
The InChIKey is NIHBYSOHEUHRKY-NEPJUHHUSA-N. The full InChI is InChI=1S/C15H28N2O5/c1-9(2)7-21-13(18)6-12(17-14(19)11(5)16)15(20)22-8-10(3)4/h9-12H,6-8,16H2,1-5H3,(H,17,19)/t11-,12+/m1/s1.
What are the key properties of bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate?
bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate has a molecular weight of 316.40 g/mol, XLogP of 0.61, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) (2S)-2-[[(2R)-2-aminopropanoyl]amino]butanedioate is sourced from PubChem (CID 146563175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).