About 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione
5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione (PubChem CID 146563952) has the molecular formula C19H17F3N2O4
and a molecular weight of 394.35 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione |
| PubChem CID | 146563952 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)NC(C)(C)C3=O)cc2)cc1OC(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O4/c1-11-4-7-14(10-15(11)28-19(20,21)22)27-13-8-5-12(6-9-13)24-16(25)18(2,3)23-17(24)26/h4-10H,1-3H3,(H,23,26) |
| InChIKey | KSLGWNMCKCMZGY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione (CID 146563952) is 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione is Cc1ccc(Oc2ccc(N3C(=O)NC(C)(C)C3=O)cc2)cc1OC(F)(F)F.
What is the InChIKey of 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione?
The InChIKey is KSLGWNMCKCMZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O4/c1-11-4-7-14(10-15(11)28-19(20,21)22)27-13-8-5-12(6-9-13)24-16(25)18(2,3)23-17(24)26/h4-10H,1-3H3,(H,23,26).
What are the key properties of 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione?
5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione has a molecular weight of 394.35 g/mol, XLogP of 4.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-[4-[4-methyl-3-(trifluoromethoxy)phenoxy]phenyl]imidazolidine-2,4-dione is sourced from PubChem (CID 146563952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).