About (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole
(5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole (PubChem CID 146564174) has the molecular formula C9H9IN2
and a molecular weight of 272.09 g/mol. Its IUPAC name is (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole.
Molecular Properties
| Compound Name | (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole |
| PubChem CID | 146564174 |
| Molecular Formula | C9H9IN2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole |
| SMILES | CC12C=c3c(ncn3I)=C[C@H]1C2 |
| InChI | InChI=1S/C9H9IN2/c1-9-3-6(9)2-7-8(4-9)12(10)5-11-7/h2,4-6H,3H2,1H3/t6-,9?/m0/s1 |
| InChIKey | SVXMYCONXGTUQX-AADKRJSRSA-N |
| XLogP | 0.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole?
The IUPAC name of (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole (CID 146564174) is (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole.
What is the SMILES notation for (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole?
The canonical SMILES for (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole is CC12C=c3c(ncn3I)=C[C@H]1C2.
What is the InChIKey of (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole?
The InChIKey is SVXMYCONXGTUQX-AADKRJSRSA-N. The full InChI is InChI=1S/C9H9IN2/c1-9-3-6(9)2-7-8(4-9)12(10)5-11-7/h2,4-6H,3H2,1H3/t6-,9?/m0/s1.
What are the key properties of (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole?
(5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole has a molecular weight of 272.09 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5aR)-3-iodo-4a-methyl-5,5a-dihydrocyclopropa[f]benzimidazole is sourced from PubChem (CID 146564174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).