C20H27FO — CID 146564216
(3E,4Z,8Z,10E)-3-ethylidene-10-fluoro-2-methoxy-4,9-dimethyl-6,7-dimethylidenetrideca-1,4,8,10-tetraene (PubChem CID 146564216) has the molecular formula C20H27FO and a molecular weight of 302.43 g/mol. Its IUPAC name is (3E,4Z,8Z,10E)-3-ethylidene-10-fluoro-2-methoxy-4,9-dimethyl-6,7-dimethylidenetrideca-1,4,8,10-tetraene.
| Compound Name | (3E,4Z,8Z,10E)-3-ethylidene-10-fluoro-2-methoxy-4,9-dimethyl-6,7-dimethylidenetrideca-1,4,8,10-tetraene |
|---|---|
| PubChem CID | 146564216 |
| Molecular Formula | C20H27FO |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (3E,4Z,8Z,10E)-3-ethylidene-10-fluoro-2-methoxy-4,9-dimethyl-6,7-dimethylidenetrideca-1,4,8,10-tetraene |
| SMILES | C=C(/C=C(C)\C(=C/C)C(=C)OC)C(=C)/C=C(C)/C(F)=C\CC |
| InChI | InChI=1S/C20H27FO/c1-9-11-20(21)17(6)13-15(4)14(3)12-16(5)19(10-2)18(7)22-8/h10-13H,3-4,7,9H2,1-2,5-6,8H3/b16-12-,17-13-,19-10+,20-11+ |
| InChIKey | JVZZESDRZLHDDB-BOFRSKJQSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|