About ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate
ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate (PubChem CID 146564239) has the molecular formula C18H18ClN3O3S
and a molecular weight of 391.88 g/mol. Its IUPAC name is ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate.
Molecular Properties
| Compound Name | ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate |
| PubChem CID | 146564239 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate |
| SMILES | CCOC(=O)CCCCOc1ccc(-c2csc3cnc(Cl)nc23)cn1 |
| InChI | InChI=1S/C18H18ClN3O3S/c1-2-24-16(23)5-3-4-8-25-15-7-6-12(9-20-15)13-11-26-14-10-21-18(19)22-17(13)14/h6-7,9-11H,2-5,8H2,1H3 |
| InChIKey | JYJLMCRUVLIYJY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate?
The IUPAC name of ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate (CID 146564239) is ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate.
What is the SMILES notation for ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate?
The canonical SMILES for ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate is CCOC(=O)CCCCOc1ccc(-c2csc3cnc(Cl)nc23)cn1.
What is the InChIKey of ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate?
The InChIKey is JYJLMCRUVLIYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN3O3S/c1-2-24-16(23)5-3-4-8-25-15-7-6-12(9-20-15)13-11-26-14-10-21-18(19)22-17(13)14/h6-7,9-11H,2-5,8H2,1H3.
What are the key properties of ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate?
ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate has a molecular weight of 391.88 g/mol, XLogP of 4.52, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[[5-(2-chlorothieno[3,2-d]pyrimidin-7-yl)-2-pyridinyl]oxy]pentanoate is sourced from PubChem (CID 146564239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).