C31H20F12 — CID 146564682
1,2,4,5-tetrafluoro-3-propan-2-yl-6-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-5-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]benzene (PubChem CID 146564682) has the molecular formula C31H20F12 and a molecular weight of 620.48 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-propan-2-yl-6-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-5-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-propan-2-yl-6-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-5-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 146564682 |
| Molecular Formula | C31H20F12 |
| Molecular Weight | 620.48 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-propan-2-yl-6-[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-5-(2,3,5,6-tetrafluoro-4-propan-2-ylphenyl)phenyl]benzene |
| SMILES | Cc1c(F)c(F)c(-c2cc(-c3c(F)c(F)c(C(C)C)c(F)c3F)cc(-c3c(F)c(F)c(C(C)C)c(F)c3F)c2)c(F)c1F |
| InChI | InChI=1S/C31H20F12/c1-9(2)15-22(34)28(40)18(29(41)23(15)35)13-6-12(17-26(38)20(32)11(5)21(33)27(17)39)7-14(8-13)19-30(42)24(36)16(10(3)4)25(37)31(19)43/h6-10H,1-5H3 |
| InChIKey | KRSJPTMKKWUMHR-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.48 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|