C12H18O3 — CID 146565108
4-(2-methylpropanoyl)bicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 146565108) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-(2-methylpropanoyl)bicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | 4-(2-methylpropanoyl)bicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 146565108 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-(2-methylpropanoyl)bicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC(C)C(=O)C12CCC(C(=O)O)(CC1)C2 |
| InChI | InChI=1S/C12H18O3/c1-8(2)9(13)11-3-5-12(7-11,6-4-11)10(14)15/h8H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | WUDFJHQCDKANFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |