About 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one
3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one (PubChem CID 146565426) has the molecular formula C8H7F3INO
and a molecular weight of 317.05 g/mol. Its IUPAC name is 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 146565426 |
| Molecular Formula | C8H7F3INO |
| Molecular Weight | 317.05 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one |
| SMILES | Cc1c(C(F)(F)F)cn(C)c(=O)c1I |
| InChI | InChI=1S/C8H7F3INO/c1-4-5(8(9,10)11)3-13(2)7(14)6(4)12/h3H,1-2H3 |
| InChIKey | PKSYDIJSAJSILJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.05 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one (CID 146565426) is 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one is Cc1c(C(F)(F)F)cn(C)c(=O)c1I.
What is the InChIKey of 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is PKSYDIJSAJSILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3INO/c1-4-5(8(9,10)11)3-13(2)7(14)6(4)12/h3H,1-2H3.
What are the key properties of 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one?
3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 317.05 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1,4-dimethyl-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 146565426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).