C33H24Cl2F6N2O4 — CID 146565586
(2S)-3-[8-(2,6-dichloro-4-fluorophenyl)-3,4-dihydro-2H-chromen-5-yl]-2-[[2,6-difluoro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]benzoyl]amino]propanoic acid (PubChem CID 146565586) has the molecular formula C33H24Cl2F6N2O4 and a molecular weight of 697.46 g/mol. Its IUPAC name is (2S)-3-[8-(2,6-dichloro-4-fluorophenyl)-3,4-dihydro-2H-chromen-5-yl]-2-[[2,6-difluoro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[8-(2,6-dichloro-4-fluorophenyl)-3,4-dihydro-2H-chromen-5-yl]-2-[[2,6-difluoro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146565586 |
| Molecular Formula | C33H24Cl2F6N2O4 |
| Molecular Weight | 697.46 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | (2S)-3-[8-(2,6-dichloro-4-fluorophenyl)-3,4-dihydro-2H-chromen-5-yl]-2-[[2,6-difluoro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(-c2c(Cl)cc(F)cc2Cl)c2c1CCCO2)C(=O)O)c1c(F)cc(N[C@H](c2ccccc2)C(F)(F)F)cc1F |
| InChI | InChI=1S/C33H24Cl2F6N2O4/c34-22-12-18(36)13-23(35)27(22)21-9-8-17(20-7-4-10-47-29(20)21)11-26(32(45)46)43-31(44)28-24(37)14-19(15-25(28)38)42-30(33(39,40)41)16-5-2-1-3-6-16/h1-3,5-6,8-9,12-15,26,30,42H,4,7,10-11H2,(H,43,44)(H,45,46)/t26-,30+/m0/s1 |
| InChIKey | JVGNLMOFVJUSLB-FREGXXQWSA-N |
| XLogP | 8.54 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.46 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |