C26H20F6N2O4 — CID 146565954
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[(E)-2-cyano-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]indole-4-carboxylic acid (PubChem CID 146565954) has the molecular formula C26H20F6N2O4 and a molecular weight of 538.44 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[(E)-2-cyano-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]indole-4-carboxylic acid.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[(E)-2-cyano-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 146565954 |
| Molecular Formula | C26H20F6N2O4 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[(E)-2-cyano-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]indole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)/C(C#N)=C/c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cccc(C(=O)O)c12 |
| InChI | InChI=1S/C26H20F6N2O4/c1-24(2,3)38-23(37)15(11-33)9-16-13-34(20-6-4-5-19(21(16)20)22(35)36)12-14-7-17(25(27,28)29)10-18(8-14)26(30,31)32/h4-10,13H,12H2,1-3H3,(H,35,36)/b15-9+ |
| InChIKey | KFGTWVZOLVNSAH-OQLLNIDSSA-N |
| XLogP | 6.67 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|