C33H39N9 — CID 146566089
2,4,6-tris(4-piperazin-1-ylphenyl)-1,3,5-triazine (PubChem CID 146566089) has the molecular formula C33H39N9 and a molecular weight of 561.74 g/mol. Its IUPAC name is 2,4,6-tris(4-piperazin-1-ylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-piperazin-1-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146566089 |
| Molecular Formula | C33H39N9 |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | 2,4,6-tris(4-piperazin-1-ylphenyl)-1,3,5-triazine |
| SMILES | c1cc(N2CCNCC2)ccc1-c1nc(-c2ccc(N3CCNCC3)cc2)nc(-c2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C33H39N9/c1-7-28(40-19-13-34-14-20-40)8-2-25(1)31-37-32(26-3-9-29(10-4-26)41-21-15-35-16-22-41)39-33(38-31)27-5-11-30(12-6-27)42-23-17-36-18-24-42/h1-12,34-36H,13-24H2 |
| InChIKey | BJKIDWOEGIYSKU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |