C41H35N5O4 — CID 146566844
(2S)-3-[8-[6-(dimethylamino)-2,4-dioxo-1H-quinazolin-3-yl]quinolin-5-yl]-2-(tritylamino)propanoic acid (PubChem CID 146566844) has the molecular formula C41H35N5O4 and a molecular weight of 661.76 g/mol. Its IUPAC name is (2S)-3-[8-[6-(dimethylamino)-2,4-dioxo-1H-quinazolin-3-yl]quinolin-5-yl]-2-(tritylamino)propanoic acid.
| Compound Name | (2S)-3-[8-[6-(dimethylamino)-2,4-dioxo-1H-quinazolin-3-yl]quinolin-5-yl]-2-(tritylamino)propanoic acid |
|---|---|
| PubChem CID | 146566844 |
| Molecular Formula | C41H35N5O4 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | (2S)-3-[8-[6-(dimethylamino)-2,4-dioxo-1H-quinazolin-3-yl]quinolin-5-yl]-2-(tritylamino)propanoic acid |
| SMILES | CN(C)c1ccc2[nH]c(=O)n(-c3ccc(C[C@H](NC(c4ccccc4)(c4ccccc4)c4ccccc4)C(=O)O)c4cccnc34)c(=O)c2c1 |
| InChI | InChI=1S/C41H35N5O4/c1-45(2)31-21-22-34-33(26-31)38(47)46(40(50)43-34)36-23-20-27(32-19-12-24-42-37(32)36)25-35(39(48)49)44-41(28-13-6-3-7-14-28,29-15-8-4-9-16-29)30-17-10-5-11-18-30/h3-24,26,35,44H,25H2,1-2H3,(H,43,50)(H,48,49)/t35-/m0/s1 |
| InChIKey | SEAACSAQAKUCKQ-DHUJRADRSA-N |
| XLogP | 5.87 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|