C45H45F3N4O8 — CID 146566875
2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione;2,2,2-trifluoroacetic acid (PubChem CID 146566875) has the molecular formula C45H45F3N4O8 and a molecular weight of 826.87 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146566875 |
| Molecular Formula | C45H45F3N4O8 |
| Molecular Weight | 826.87 g/mol |
| Exact Mass | 826.32 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCCCN2CCN(c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C43H44N4O6.C2HF3O2/c1-2-35(29-8-4-3-5-9-29)40(30-10-15-33(48)16-11-30)31-12-17-34(18-13-31)53-27-7-6-22-45-23-25-46(26-24-45)32-14-19-36-37(28-32)43(52)47(42(36)51)38-20-21-39(49)44-41(38)50;3-2(4,5)1(6)7/h3-5,8-19,28,38,48H,2,6-7,20-27H2,1H3,(H,44,49,50);(H,6,7) |
| InChIKey | LVHHHETUFAEEEE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.87 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|